C12H21N3 — CID 150601904
4-N-(6-aminohexyl)benzene-1,4-diamine (PubChem CID 150601904) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-N-(6-aminohexyl)benzene-1,4-diamine.
| Compound Name | 4-N-(6-aminohexyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 150601904 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-N-(6-aminohexyl)benzene-1,4-diamine |
| SMILES | NCCCCCCNc1ccc(N)cc1 |
| InChI | InChI=1S/C12H21N3/c13-9-3-1-2-4-10-15-12-7-5-11(14)6-8-12/h5-8,15H,1-4,9-10,13-14H2 |
| InChIKey | ISBALQKWPQDBRA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|