C14H24N2O2S — CID 139472179
4-N-(7-methylsulfonylheptyl)benzene-1,4-diamine (PubChem CID 139472179) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 4-N-(7-methylsulfonylheptyl)benzene-1,4-diamine.
| Compound Name | 4-N-(7-methylsulfonylheptyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 139472179 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-N-(7-methylsulfonylheptyl)benzene-1,4-diamine |
| SMILES | CS(=O)(=O)CCCCCCCNc1ccc(N)cc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-19(17,18)12-6-4-2-3-5-11-16-14-9-7-13(15)8-10-14/h7-10,16H,2-6,11-12,15H2,1H3 |
| InChIKey | XSRGVSPPHFTVCO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|