C17H24N4 — CID 163689454
4-N-[3-[4-(ethylamino)anilino]propyl]benzene-1,4-diamine (PubChem CID 163689454) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-[3-[4-(ethylamino)anilino]propyl]benzene-1,4-diamine.
| Compound Name | 4-N-[3-[4-(ethylamino)anilino]propyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 163689454 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-[3-[4-(ethylamino)anilino]propyl]benzene-1,4-diamine |
| SMILES | CCNc1ccc(NCCCNc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H24N4/c1-2-19-15-8-10-17(11-9-15)21-13-3-12-20-16-6-4-14(18)5-7-16/h4-11,19-21H,2-3,12-13,18H2,1H3 |
| InChIKey | JRRWLKHRARIFBH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|