C8H11BrN2 — CID 70360117
4-N-(2-bromoethyl)benzene-1,4-diamine (PubChem CID 70360117) has the molecular formula C8H11BrN2 and a molecular weight of 215.09 g/mol. Its IUPAC name is 4-N-(2-bromoethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2-bromoethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 70360117 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 4-N-(2-bromoethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCBr)cc1 |
| InChI | InChI=1S/C8H11BrN2/c9-5-6-11-8-3-1-7(10)2-4-8/h1-4,11H,5-6,10H2 |
| InChIKey | CLFVCJNOTPYTPN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|