C8H11N3O — CID 131970603
4-N-(2-nitrosoethyl)benzene-1,4-diamine (PubChem CID 131970603) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-N-(2-nitrosoethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2-nitrosoethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 131970603 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-N-(2-nitrosoethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCN=O)cc1 |
| InChI | InChI=1S/C8H11N3O/c9-7-1-3-8(4-2-7)10-5-6-11-12/h1-4,10H,5-6,9H2 |
| InChIKey | ASRKHZDNMNRPEP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|