About 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride
2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride (PubChem CID 22155037) has the molecular formula C11H21ClIN3
and a molecular weight of 357.67 g/mol. Its IUPAC name is 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride |
| PubChem CID | 22155037 |
| Molecular Formula | C11H21ClIN3 |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride |
| SMILES | C[N+](C)(C)CCNc1ccc(N)cc1.Cl.[I-] |
| InChI | InChI=1S/C11H20N3.ClH.HI/c1-14(2,3)9-8-13-11-6-4-10(12)5-7-11;;/h4-7,13H,8-9,12H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | UNMGHVDNVNMSNV-UHFFFAOYSA-M |
| XLogP | -1.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride?
The IUPAC name of 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride (CID 22155037) is 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride.
What is the SMILES notation for 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride?
The canonical SMILES for 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride is C[N+](C)(C)CCNc1ccc(N)cc1.Cl.[I-].
What is the InChIKey of 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride?
The InChIKey is UNMGHVDNVNMSNV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20N3.ClH.HI/c1-14(2,3)9-8-13-11-6-4-10(12)5-7-11;;/h4-7,13H,8-9,12H2,1-3H3;2*1H/q+1;;/p-1.
What are the key properties of 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride?
2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride has a molecular weight of 357.67 g/mol, XLogP of -1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminoanilino)ethyl-trimethylazanium;iodide;hydrochloride is sourced from PubChem (CID 22155037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).