C11H21N4+ — CID 90023471
2-(2,4-diaminoanilino)ethyl-trimethylazanium (PubChem CID 90023471) has the molecular formula C11H21N4+ and a molecular weight of 209.32 g/mol. Its IUPAC name is 2-(2,4-diaminoanilino)ethyl-trimethylazanium.
| Compound Name | 2-(2,4-diaminoanilino)ethyl-trimethylazanium |
|---|---|
| PubChem CID | 90023471 |
| Molecular Formula | C11H21N4+ |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-(2,4-diaminoanilino)ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNc1ccc(N)cc1N |
| InChI | InChI=1S/C11H21N4/c1-15(2,3)7-6-14-11-5-4-9(12)8-10(11)13/h4-5,8,14H,6-7,12-13H2,1-3H3/q+1 |
| InChIKey | ZWRHFVSSUAKDSV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|