C23H38N5+ — CID 89397376
bis[3-(4-amino-2-methylanilino)propyl]-ethyl-methylazanium (PubChem CID 89397376) has the molecular formula C23H38N5+ and a molecular weight of 384.59 g/mol. Its IUPAC name is bis[3-(4-amino-2-methylanilino)propyl]-ethyl-methylazanium.
| Compound Name | bis[3-(4-amino-2-methylanilino)propyl]-ethyl-methylazanium |
|---|---|
| PubChem CID | 89397376 |
| Molecular Formula | C23H38N5+ |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | bis[3-(4-amino-2-methylanilino)propyl]-ethyl-methylazanium |
| SMILES | CC[N+](C)(CCCNc1ccc(N)cc1C)CCCNc1ccc(N)cc1C |
| InChI | InChI=1S/C23H38N5/c1-5-28(4,14-6-12-26-22-10-8-20(24)16-18(22)2)15-7-13-27-23-11-9-21(25)17-19(23)3/h8-11,16-17,26-27H,5-7,12-15,24-25H2,1-4H3/q+1 |
| InChIKey | UKBQOQPQJQVSLB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|