C10H13N2O2- — CID 23104650
3-(4-amino-2-methylanilino)propanoate (PubChem CID 23104650) has the molecular formula C10H13N2O2- and a molecular weight of 193.23 g/mol. Its IUPAC name is 3-(4-amino-2-methylanilino)propanoate.
| Compound Name | 3-(4-amino-2-methylanilino)propanoate |
|---|---|
| PubChem CID | 23104650 |
| Molecular Formula | C10H13N2O2- |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 3-(4-amino-2-methylanilino)propanoate |
| SMILES | Cc1cc(N)ccc1NCCC(=O)[O-] |
| InChI | InChI=1S/C10H14N2O2/c1-7-6-8(11)2-3-9(7)12-5-4-10(13)14/h2-3,6,12H,4-5,11H2,1H3,(H,13,14)/p-1 |
| InChIKey | GPSKRNPIURSVMT-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|