C10H14IN3O — CID 66092939
3-(4-amino-2-iodoanilino)-N-methylpropanamide (PubChem CID 66092939) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is 3-(4-amino-2-iodoanilino)-N-methylpropanamide.
| Compound Name | 3-(4-amino-2-iodoanilino)-N-methylpropanamide |
|---|---|
| PubChem CID | 66092939 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-(4-amino-2-iodoanilino)-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1ccc(N)cc1I |
| InChI | InChI=1S/C10H14IN3O/c1-13-10(15)4-5-14-9-3-2-7(12)6-8(9)11/h2-3,6,14H,4-5,12H2,1H3,(H,13,15) |
| InChIKey | BWQWHCXVVTVYTA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|