C10H16IN3 — CID 66095990
1-N-[2-(dimethylamino)ethyl]-2-iodobenzene-1,4-diamine (PubChem CID 66095990) has the molecular formula C10H16IN3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 66095990 |
| Molecular Formula | C10H16IN3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-2-iodobenzene-1,4-diamine |
| SMILES | CN(C)CCNc1ccc(N)cc1I |
| InChI | InChI=1S/C10H16IN3/c1-14(2)6-5-13-10-4-3-8(12)7-9(10)11/h3-4,7,13H,5-6,12H2,1-2H3 |
| InChIKey | QSBWICFHQGCJHK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|