C11H17IN2 — CID 130497985
N-(5-iodo-2-methylphenyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 130497985) has the molecular formula C11H17IN2 and a molecular weight of 304.18 g/mol. Its IUPAC name is N-(5-iodo-2-methylphenyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(5-iodo-2-methylphenyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 130497985 |
| Molecular Formula | C11H17IN2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(5-iodo-2-methylphenyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | Cc1ccc(I)cc1NCCN(C)C |
| InChI | InChI=1S/C11H17IN2/c1-9-4-5-10(12)8-11(9)13-6-7-14(2)3/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | DEIRSMFHZSOXFS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|