C12H20N2 — CID 3021697
N',N'-dimethyl-N-(2-methylphenyl)propane-1,3-diamine (PubChem CID 3021697) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-methylphenyl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(2-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 3021697 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N',N'-dimethyl-N-(2-methylphenyl)propane-1,3-diamine |
| SMILES | Cc1ccccc1NCCCN(C)C |
| InChI | InChI=1S/C12H20N2/c1-11-7-4-5-8-12(11)13-9-6-10-14(2)3/h4-5,7-8,13H,6,9-10H2,1-3H3 |
| InChIKey | ZOGWRTUVHRNZEG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|