About 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine
3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine (PubChem CID 86225752) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine.
Molecular Properties
| Compound Name | 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine |
| PubChem CID | 86225752 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine |
| SMILES | CN(C)CCCNc1cccc(N)c1N |
| InChI | InChI=1S/C11H20N4/c1-15(2)8-4-7-14-10-6-3-5-9(12)11(10)13/h3,5-6,14H,4,7-8,12-13H2,1-2H3 |
| InChIKey | SFACZLIZOIIQSM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine?
The IUPAC name of 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine (CID 86225752) is 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine.
What is the SMILES notation for 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine?
The canonical SMILES for 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine is CN(C)CCCNc1cccc(N)c1N.
What is the InChIKey of 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine?
The InChIKey is SFACZLIZOIIQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-15(2)8-4-7-14-10-6-3-5-9(12)11(10)13/h3,5-6,14H,4,7-8,12-13H2,1-2H3.
What are the key properties of 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine?
3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine has a molecular weight of 208.31 g/mol, XLogP of 1.21, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine is sourced from PubChem (CID 86225752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).