C11H20N4 — CID 86225752
3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine (PubChem CID 86225752) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine.
| Compound Name | 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine |
|---|---|
| PubChem CID | 86225752 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 3-N-[3-(dimethylamino)propyl]benzene-1,2,3-triamine |
| SMILES | CN(C)CCCNc1cccc(N)c1N |
| InChI | InChI=1S/C11H20N4/c1-15(2)8-4-7-14-10-6-3-5-9(12)11(10)13/h3,5-6,14H,4,7-8,12-13H2,1-2H3 |
| InChIKey | SFACZLIZOIIQSM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|