C24H34Cl2N4O2 — CID 131875153
1,5-bis[3-(dimethylamino)propylamino]anthracene-9,10-dione;dihydrochloride (PubChem CID 131875153) has the molecular formula C24H34Cl2N4O2 and a molecular weight of 481.47 g/mol. Its IUPAC name is 1,5-bis[3-(dimethylamino)propylamino]anthracene-9,10-dione;dihydrochloride.
| Compound Name | 1,5-bis[3-(dimethylamino)propylamino]anthracene-9,10-dione;dihydrochloride |
|---|---|
| PubChem CID | 131875153 |
| Molecular Formula | C24H34Cl2N4O2 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1,5-bis[3-(dimethylamino)propylamino]anthracene-9,10-dione;dihydrochloride |
| SMILES | CN(C)CCCNc1cccc2c1C(=O)c1cccc(NCCCN(C)C)c1C2=O.Cl.Cl |
| InChI | InChI=1S/C24H32N4O2.2ClH/c1-27(2)15-7-13-25-19-11-5-9-17-21(19)23(29)18-10-6-12-20(22(18)24(17)30)26-14-8-16-28(3)4;;/h5-6,9-12,25-26H,7-8,13-16H2,1-4H3;2*1H |
| InChIKey | IYOBGXKQJPBKIT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|