C26H38N4O2+2 — CID 169006734
3-[[9,10-dioxo-8-[3-(trimethylazaniumyl)propylamino]anthracen-1-yl]amino]propyl-trimethylazanium (PubChem CID 169006734) has the molecular formula C26H38N4O2+2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 3-[[9,10-dioxo-8-[3-(trimethylazaniumyl)propylamino]anthracen-1-yl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[9,10-dioxo-8-[3-(trimethylazaniumyl)propylamino]anthracen-1-yl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 169006734 |
| Molecular Formula | C26H38N4O2+2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 3-[[9,10-dioxo-8-[3-(trimethylazaniumyl)propylamino]anthracen-1-yl]amino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNc1cccc2c1C(=O)c1c(NCCC[N+](C)(C)C)cccc1C2=O |
| InChI | InChI=1S/C26H37N4O2/c1-29(2,3)17-9-15-27-21-13-7-11-19-23(21)26(32)24-20(25(19)31)12-8-14-22(24)28-16-10-18-30(4,5)6/h7-8,11-14H,9-10,15-18H2,1-6H3,(H-,27,28,32)/q+1/p+1 |
| InChIKey | LSJPPVCVBGIUOU-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|