C22H30N4O2+2 — CID 145157529
2-azaniumylethyl-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-methyl-[2-(methylamino)ethyl]azanium (PubChem CID 145157529) has the molecular formula C22H30N4O2+2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-azaniumylethyl-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-methyl-[2-(methylamino)ethyl]azanium.
| Compound Name | 2-azaniumylethyl-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-methyl-[2-(methylamino)ethyl]azanium |
|---|---|
| PubChem CID | 145157529 |
| Molecular Formula | C22H30N4O2+2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 2-azaniumylethyl-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-methyl-[2-(methylamino)ethyl]azanium |
| SMILES | CNCC[N+](C)(CC[NH3+])CCNc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H28N4O2/c1-24-11-14-26(2,13-10-23)15-12-25-19-9-5-8-18-20(19)22(28)17-7-4-3-6-16(17)21(18)27/h3-9,24H,10-15,23H2,1-2H3/p+2 |
| InChIKey | XYHXLSXUIOVEPH-UHFFFAOYSA-P |
| XLogP | 0.78 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|