C36H35BrN4O4 — CID 162327953
2-[(9,10-dioxoanthracen-1-yl)amino]ethyl-dimethyl-[3-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]propyl]azanium bromide (PubChem CID 162327953) has the molecular formula C36H35BrN4O4 and a molecular weight of 667.60 g/mol. Its IUPAC name is 2-[(9,10-dioxoanthracen-1-yl)amino]ethyl-dimethyl-[3-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]propyl]azanium bromide.
| Compound Name | 2-[(9,10-dioxoanthracen-1-yl)amino]ethyl-dimethyl-[3-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]propyl]azanium bromide |
|---|---|
| PubChem CID | 162327953 |
| Molecular Formula | C36H35BrN4O4 |
| Molecular Weight | 667.60 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | 2-[(9,10-dioxoanthracen-1-yl)amino]ethyl-dimethyl-[3-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]propyl]azanium bromide |
| SMILES | CNc1ccc(NCCC[N+](C)(C)CCNc2cccc3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C36H34N4O4.BrH/c1-37-27-16-17-29(32-31(27)35(43)24-12-6-7-13-25(24)36(32)44)38-18-9-20-40(2,3)21-19-39-28-15-8-14-26-30(28)34(42)23-11-5-4-10-22(23)33(26)41;/h4-8,10-17H,9,18-21H2,1-3H3,(H2-,37,38,39,41,42,43,44);1H |
| InChIKey | OMRDXEUKYBXYMV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|