C22H27Br2N3O2 — CID 162322629
3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(3-bromopropyl)-dimethylazanium bromide (PubChem CID 162322629) has the molecular formula C22H27Br2N3O2 and a molecular weight of 525.29 g/mol. Its IUPAC name is 3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(3-bromopropyl)-dimethylazanium bromide.
| Compound Name | 3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(3-bromopropyl)-dimethylazanium bromide |
|---|---|
| PubChem CID | 162322629 |
| Molecular Formula | C22H27Br2N3O2 |
| Molecular Weight | 525.29 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(3-bromopropyl)-dimethylazanium bromide |
| SMILES | C[N+](C)(CCCBr)CCCNc1ccc(N)c2c1C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C22H26BrN3O2.BrH/c1-26(2,13-5-11-23)14-6-12-25-18-10-9-17(24)19-20(18)22(28)16-8-4-3-7-15(16)21(19)27;/h3-4,7-10H,5-6,11-14H2,1-2H3,(H2-,24,25,27,28);1H |
| InChIKey | MINZFALFEGZZKH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|