C22H27BrN3O2+ — CID 159858752
3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(4-bromobutyl)-methylazanium (PubChem CID 159858752) has the molecular formula C22H27BrN3O2+ and a molecular weight of 445.38 g/mol. Its IUPAC name is 3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(4-bromobutyl)-methylazanium.
| Compound Name | 3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(4-bromobutyl)-methylazanium |
|---|---|
| PubChem CID | 159858752 |
| Molecular Formula | C22H27BrN3O2+ |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-[(4-amino-9,10-dioxoanthracen-1-yl)amino]propyl-(4-bromobutyl)-methylazanium |
| SMILES | C[NH+](CCCCBr)CCCNc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H26BrN3O2/c1-26(13-5-4-11-23)14-6-12-25-18-10-9-17(24)19-20(18)22(28)16-8-3-2-7-15(16)21(19)27/h2-3,7-10,25H,4-6,11-14,24H2,1H3/p+1 |
| InChIKey | NQWFBEPPCOVOBX-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|