C44H74Br2N4O2 — CID 174052624
1,4-bis[4-(dimethylamino)tridecylamino]anthracene-9,10-dione;dihydrobromide (PubChem CID 174052624) has the molecular formula C44H74Br2N4O2 and a molecular weight of 850.91 g/mol. Its IUPAC name is 1,4-bis[4-(dimethylamino)tridecylamino]anthracene-9,10-dione;dihydrobromide.
| Compound Name | 1,4-bis[4-(dimethylamino)tridecylamino]anthracene-9,10-dione;dihydrobromide |
|---|---|
| PubChem CID | 174052624 |
| Molecular Formula | C44H74Br2N4O2 |
| Molecular Weight | 850.91 g/mol |
| Exact Mass | 848.42 |
| IUPAC Name | 1,4-bis[4-(dimethylamino)tridecylamino]anthracene-9,10-dione;dihydrobromide |
| SMILES | Br.Br.CCCCCCCCCC(CCCNc1ccc(NCCCC(CCCCCCCCC)N(C)C)c2c1C(=O)c1ccccc1C2=O)N(C)C |
| InChI | InChI=1S/C44H72N4O2.2BrH/c1-7-9-11-13-15-17-19-25-35(47(3)4)27-23-33-45-39-31-32-40(42-41(39)43(49)37-29-21-22-30-38(37)44(42)50)46-34-24-28-36(48(5)6)26-20-18-16-14-12-10-8-2;;/h21-22,29-32,35-36,45-46H,7-20,23-28,33-34H2,1-6H3;2*1H |
| InChIKey | LWHUSFWNGLKWHI-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.91 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|