C42H66N2O2 — CID 67821962
1,4-bis(8-ethyldodecan-6-ylamino)anthracene-9,10-dione (PubChem CID 67821962) has the molecular formula C42H66N2O2 and a molecular weight of 631.00 g/mol. Its IUPAC name is 1,4-bis(8-ethyldodecan-6-ylamino)anthracene-9,10-dione.
| Compound Name | 1,4-bis(8-ethyldodecan-6-ylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 67821962 |
| Molecular Formula | C42H66N2O2 |
| Molecular Weight | 631.00 g/mol |
| Exact Mass | 630.51 |
| IUPAC Name | 1,4-bis(8-ethyldodecan-6-ylamino)anthracene-9,10-dione |
| SMILES | CCCCCC(CC(CC)CCCC)Nc1ccc(NC(CCCCC)CC(CC)CCCC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C42H66N2O2/c1-7-13-17-23-33(29-31(11-5)21-15-9-3)43-37-27-28-38(40-39(37)41(45)35-25-19-20-26-36(35)42(40)46)44-34(24-18-14-8-2)30-32(12-6)22-16-10-4/h19-20,25-28,31-34,43-44H,7-18,21-24,29-30H2,1-6H3 |
| InChIKey | VKTKTGFYAXPHPJ-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.00 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|