C22H24BrNO2 — CID 89487467
1-bromo-4-(2-ethylhexylamino)anthracene-9,10-dione (PubChem CID 89487467) has the molecular formula C22H24BrNO2 and a molecular weight of 414.34 g/mol. Its IUPAC name is 1-bromo-4-(2-ethylhexylamino)anthracene-9,10-dione.
| Compound Name | 1-bromo-4-(2-ethylhexylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 89487467 |
| Molecular Formula | C22H24BrNO2 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-bromo-4-(2-ethylhexylamino)anthracene-9,10-dione |
| SMILES | CCCCC(CC)CNc1ccc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H24BrNO2/c1-3-5-8-14(4-2)13-24-18-12-11-17(23)19-20(18)22(26)16-10-7-6-9-15(16)21(19)25/h6-7,9-12,14,24H,3-5,8,13H2,1-2H3 |
| InChIKey | GITSJWCHNMHFJB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|