C14H21F2N — CID 63490651
N-(2-ethylhexyl)-2,3-difluoroaniline (PubChem CID 63490651) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(2-ethylhexyl)-2,3-difluoroaniline.
| Compound Name | N-(2-ethylhexyl)-2,3-difluoroaniline |
|---|---|
| PubChem CID | 63490651 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-(2-ethylhexyl)-2,3-difluoroaniline |
| SMILES | CCCCC(CC)CNc1cccc(F)c1F |
| InChI | InChI=1S/C14H21F2N/c1-3-5-7-11(4-2)10-17-13-9-6-8-12(15)14(13)16/h6,8-9,11,17H,3-5,7,10H2,1-2H3 |
| InChIKey | PLLGRCMOAWBCKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |