C12H17F2NO2 — CID 81093077
N-(2,2-diethoxyethyl)-2,3-difluoroaniline (PubChem CID 81093077) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-2,3-difluoroaniline.
| Compound Name | N-(2,2-diethoxyethyl)-2,3-difluoroaniline |
|---|---|
| PubChem CID | 81093077 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(2,2-diethoxyethyl)-2,3-difluoroaniline |
| SMILES | CCOC(CNc1cccc(F)c1F)OCC |
| InChI | InChI=1S/C12H17F2NO2/c1-3-16-11(17-4-2)8-15-10-7-5-6-9(13)12(10)14/h5-7,11,15H,3-4,8H2,1-2H3 |
| InChIKey | FUFPAEWKGUZLMQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|