C7H7F2N — CID 50998712
2,3-difluoro-N-methylaniline (PubChem CID 50998712) has the molecular formula C7H7F2N and a molecular weight of 143.14 g/mol. Its IUPAC name is 2,3-difluoro-N-methylaniline.
| Compound Name | 2,3-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 50998712 |
| Molecular Formula | C7H7F2N |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2,3-difluoro-N-methylaniline |
| SMILES | CNc1cccc(F)c1F |
| InChI | InChI=1S/C7H7F2N/c1-10-6-4-2-3-5(8)7(6)9/h2-4,10H,1H3 |
| InChIKey | ZULZSZSNTGKQDZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |