C9H12F3N — CID 157043663
ethane;2,3,4-trifluoro-N-methylaniline (PubChem CID 157043663) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is ethane;2,3,4-trifluoro-N-methylaniline.
| Compound Name | ethane;2,3,4-trifluoro-N-methylaniline |
|---|---|
| PubChem CID | 157043663 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | ethane;2,3,4-trifluoro-N-methylaniline |
| SMILES | CC.CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H6F3N.C2H6/c1-11-5-3-2-4(8)6(9)7(5)10;1-2/h2-3,11H,1H3;1-2H3 |
| InChIKey | GWMMBIXTFOAYRR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|