C6H3F4N — CID 54516145
N,2,3,4-tetrafluoroaniline (PubChem CID 54516145) has the molecular formula C6H3F4N and a molecular weight of 165.09 g/mol. Its IUPAC name is N,2,3,4-tetrafluoroaniline.
| Compound Name | N,2,3,4-tetrafluoroaniline |
|---|---|
| PubChem CID | 54516145 |
| Molecular Formula | C6H3F4N |
| Molecular Weight | 165.09 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | N,2,3,4-tetrafluoroaniline |
| SMILES | FNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C6H3F4N/c7-3-1-2-4(11-10)6(9)5(3)8/h1-2,11H |
| InChIKey | ZMOLZYIGTOMBLR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|