C11H12F3N — CID 66045918
2,3,4-trifluoro-N-(2-methylidenebutyl)aniline (PubChem CID 66045918) has the molecular formula C11H12F3N and a molecular weight of 215.22 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(2-methylidenebutyl)aniline.
| Compound Name | 2,3,4-trifluoro-N-(2-methylidenebutyl)aniline |
|---|---|
| PubChem CID | 66045918 |
| Molecular Formula | C11H12F3N |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2,3,4-trifluoro-N-(2-methylidenebutyl)aniline |
| SMILES | C=C(CC)CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H12F3N/c1-3-7(2)6-15-9-5-4-8(12)10(13)11(9)14/h4-5,15H,2-3,6H2,1H3 |
| InChIKey | PMIOKLKXOMNHDK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|