C12H16F3N3O — CID 108994740
N-[2-(dimethylamino)ethyl]-2-(2,3,4-trifluoroanilino)acetamide (PubChem CID 108994740) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(2,3,4-trifluoroanilino)acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(2,3,4-trifluoroanilino)acetamide |
|---|---|
| PubChem CID | 108994740 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(2,3,4-trifluoroanilino)acetamide |
| SMILES | CN(C)CCNC(=O)CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H16F3N3O/c1-18(2)6-5-16-10(19)7-17-9-4-3-8(13)11(14)12(9)15/h3-4,17H,5-7H2,1-2H3,(H,16,19) |
| InChIKey | MYRUZZFYIGDBTO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|