C13H16F2N2O3 — CID 79838074
methyl 2,3-difluoro-4-[[2-oxo-2-(propylamino)ethyl]amino]benzoate (PubChem CID 79838074) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-[[2-oxo-2-(propylamino)ethyl]amino]benzoate.
| Compound Name | methyl 2,3-difluoro-4-[[2-oxo-2-(propylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 79838074 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 2,3-difluoro-4-[[2-oxo-2-(propylamino)ethyl]amino]benzoate |
| SMILES | CCCNC(=O)CNc1ccc(C(=O)OC)c(F)c1F |
| InChI | InChI=1S/C13H16F2N2O3/c1-3-6-16-10(18)7-17-9-5-4-8(13(19)20-2)11(14)12(9)15/h4-5,17H,3,6-7H2,1-2H3,(H,16,18) |
| InChIKey | XYUOODXUBHZWQX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |