C11H14F2N2O4S — CID 106337575
methyl 2,3-difluoro-4-[2-(methylsulfamoyl)ethylamino]benzoate (PubChem CID 106337575) has the molecular formula C11H14F2N2O4S and a molecular weight of 308.31 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-[2-(methylsulfamoyl)ethylamino]benzoate.
| Compound Name | methyl 2,3-difluoro-4-[2-(methylsulfamoyl)ethylamino]benzoate |
|---|---|
| PubChem CID | 106337575 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | methyl 2,3-difluoro-4-[2-(methylsulfamoyl)ethylamino]benzoate |
| SMILES | CNS(=O)(=O)CCNc1ccc(C(=O)OC)c(F)c1F |
| InChI | InChI=1S/C11H14F2N2O4S/c1-14-20(17,18)6-5-15-8-4-3-7(11(16)19-2)9(12)10(8)13/h3-4,14-15H,5-6H2,1-2H3 |
| InChIKey | FSWGIISLZPEGBB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |