C10H11F2N3O2S — CID 114175359
2-(4-cyano-2,3-difluoroanilino)-N-methylethanesulfonamide (PubChem CID 114175359) has the molecular formula C10H11F2N3O2S and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-(4-cyano-2,3-difluoroanilino)-N-methylethanesulfonamide.
| Compound Name | 2-(4-cyano-2,3-difluoroanilino)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 114175359 |
| Molecular Formula | C10H11F2N3O2S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-(4-cyano-2,3-difluoroanilino)-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C10H11F2N3O2S/c1-14-18(16,17)5-4-15-8-3-2-7(6-13)9(11)10(8)12/h2-3,14-15H,4-5H2,1H3 |
| InChIKey | QAAJZLMBDBJQCX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |