C10H10F2N4O — CID 107934087
2-(4-cyano-2,3-difluoroanilino)ethylurea (PubChem CID 107934087) has the molecular formula C10H10F2N4O and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-(4-cyano-2,3-difluoroanilino)ethylurea.
| Compound Name | 2-(4-cyano-2,3-difluoroanilino)ethylurea |
|---|---|
| PubChem CID | 107934087 |
| Molecular Formula | C10H10F2N4O |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(4-cyano-2,3-difluoroanilino)ethylurea |
| SMILES | N#Cc1ccc(NCCNC(N)=O)c(F)c1F |
| InChI | InChI=1S/C10H10F2N4O/c11-8-6(5-13)1-2-7(9(8)12)15-3-4-16-10(14)17/h1-2,15H,3-4H2,(H3,14,16,17) |
| InChIKey | OSQANEVRBJEJNH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|