C15H12F2N2 — CID 107933230
2,3-difluoro-4-(2-phenylethylamino)benzonitrile (PubChem CID 107933230) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-phenylethylamino)benzonitrile.
| Compound Name | 2,3-difluoro-4-(2-phenylethylamino)benzonitrile |
|---|---|
| PubChem CID | 107933230 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,3-difluoro-4-(2-phenylethylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C15H12F2N2/c16-14-12(10-18)6-7-13(15(14)17)19-9-8-11-4-2-1-3-5-11/h1-7,19H,8-9H2 |
| InChIKey | XYYRMHMLNHSXSR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |