C15H10F4N2 — CID 107933737
4-[2-(3,5-difluorophenyl)ethylamino]-2,3-difluorobenzonitrile (PubChem CID 107933737) has the molecular formula C15H10F4N2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenyl)ethylamino]-2,3-difluorobenzonitrile.
| Compound Name | 4-[2-(3,5-difluorophenyl)ethylamino]-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933737 |
| Molecular Formula | C15H10F4N2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[2-(3,5-difluorophenyl)ethylamino]-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(NCCc2cc(F)cc(F)c2)c(F)c1F |
| InChI | InChI=1S/C15H10F4N2/c16-11-5-9(6-12(17)7-11)3-4-21-13-2-1-10(8-20)14(18)15(13)19/h1-2,5-7,21H,3-4H2 |
| InChIKey | IJRMRUUJHPUDMX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |