C15H13F2N3 — CID 62605345
3-amino-4-[2-(3,5-difluorophenyl)ethylamino]benzonitrile (PubChem CID 62605345) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-amino-4-[2-(3,5-difluorophenyl)ethylamino]benzonitrile.
| Compound Name | 3-amino-4-[2-(3,5-difluorophenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 62605345 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-amino-4-[2-(3,5-difluorophenyl)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCc2cc(F)cc(F)c2)c(N)c1 |
| InChI | InChI=1S/C15H13F2N3/c16-12-5-10(6-13(17)8-12)3-4-20-15-2-1-11(9-18)7-14(15)19/h1-2,5-8,20H,3-4,19H2 |
| InChIKey | JMZHXKFAWBBPQM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|