C14H12BrF3N2 — CID 116735859
4-bromo-2-N-[2-(3,5-difluorophenyl)ethyl]-5-fluorobenzene-1,2-diamine (PubChem CID 116735859) has the molecular formula C14H12BrF3N2 and a molecular weight of 345.16 g/mol. Its IUPAC name is 4-bromo-2-N-[2-(3,5-difluorophenyl)ethyl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-[2-(3,5-difluorophenyl)ethyl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 116735859 |
| Molecular Formula | C14H12BrF3N2 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4-bromo-2-N-[2-(3,5-difluorophenyl)ethyl]-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H12BrF3N2/c15-11-6-14(13(19)7-12(11)18)20-2-1-8-3-9(16)5-10(17)4-8/h3-7,20H,1-2,19H2 |
| InChIKey | LHOWYJODJQOGGS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|