C9H12BrFN4O — CID 116736207
2-(2-amino-5-bromo-4-fluoroanilino)ethylurea (PubChem CID 116736207) has the molecular formula C9H12BrFN4O and a molecular weight of 291.12 g/mol. Its IUPAC name is 2-(2-amino-5-bromo-4-fluoroanilino)ethylurea.
| Compound Name | 2-(2-amino-5-bromo-4-fluoroanilino)ethylurea |
|---|---|
| PubChem CID | 116736207 |
| Molecular Formula | C9H12BrFN4O |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-(2-amino-5-bromo-4-fluoroanilino)ethylurea |
| SMILES | NC(=O)NCCNc1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C9H12BrFN4O/c10-5-3-8(7(12)4-6(5)11)14-1-2-15-9(13)16/h3-4,14H,1-2,12H2,(H3,13,15,16) |
| InChIKey | DYHFMNNLGZKROB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|