C10H13BrFN3O — CID 116735517
N-[2-(2-amino-5-bromo-4-fluoroanilino)ethyl]acetamide (PubChem CID 116735517) has the molecular formula C10H13BrFN3O and a molecular weight of 290.14 g/mol. Its IUPAC name is N-[2-(2-amino-5-bromo-4-fluoroanilino)ethyl]acetamide.
| Compound Name | N-[2-(2-amino-5-bromo-4-fluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 116735517 |
| Molecular Formula | C10H13BrFN3O |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-[2-(2-amino-5-bromo-4-fluoroanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C10H13BrFN3O/c1-6(16)14-2-3-15-10-4-7(11)8(12)5-9(10)13/h4-5,15H,2-3,13H2,1H3,(H,14,16) |
| InChIKey | YEEADXCVDCXAEN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|