C10H13F2N3O — CID 61015513
N-[2-(4-amino-2,6-difluoroanilino)ethyl]acetamide (PubChem CID 61015513) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is N-[2-(4-amino-2,6-difluoroanilino)ethyl]acetamide.
| Compound Name | N-[2-(4-amino-2,6-difluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 61015513 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-[2-(4-amino-2,6-difluoroanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCNc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H13F2N3O/c1-6(16)14-2-3-15-10-8(11)4-7(13)5-9(10)12/h4-5,15H,2-3,13H2,1H3,(H,14,16) |
| InChIKey | FJCXSLBPCUTFHP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|