C10H11Cl2FN2O — CID 107529850
N-[2-(2,6-dichloro-4-fluoroanilino)ethyl]acetamide (PubChem CID 107529850) has the molecular formula C10H11Cl2FN2O and a molecular weight of 265.12 g/mol. Its IUPAC name is N-[2-(2,6-dichloro-4-fluoroanilino)ethyl]acetamide.
| Compound Name | N-[2-(2,6-dichloro-4-fluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 107529850 |
| Molecular Formula | C10H11Cl2FN2O |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | N-[2-(2,6-dichloro-4-fluoroanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H11Cl2FN2O/c1-6(16)14-2-3-15-10-8(11)4-7(13)5-9(10)12/h4-5,15H,2-3H2,1H3,(H,14,16) |
| InChIKey | FWRFRSGYYMBGIR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|