methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate

C11H12Cl2FNO2 — CID 83079185

IUPACmethyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate
SMILESCOC(=O)C(C)CNc1c(Cl)cc(F)cc1Cl
InChIInChI=1S/C11H12Cl2FNO2/c1-6(11(16)17-2)5-15-10-8(12)3-7(14)4-9(10)13/h3-4,6,15H,5H2,1-2H3
InChIKeyBDSHEKGGHKXGFL-UHFFFAOYSA-N
MW280.13 g/mol
LogP3.35
Rot. Bonds4

About methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate

methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate (PubChem CID 83079185) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate.

Molecular Properties

Compound Namemethyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate
PubChem CID83079185
Molecular FormulaC11H12Cl2FNO2
Molecular Weight280.13 g/mol
Exact Mass279.02
IUPAC Namemethyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate
SMILESCOC(=O)C(C)CNc1c(Cl)cc(F)cc1Cl
InChIInChI=1S/C11H12Cl2FNO2/c1-6(11(16)17-2)5-15-10-8(12)3-7(14)4-9(10)13/h3-4,6,15H,5H2,1-2H3
InChIKeyBDSHEKGGHKXGFL-UHFFFAOYSA-N
XLogP3.35
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.13
LogP ≤ 53.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate?
The IUPAC name of methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate (CID 83079185) is methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate.
What is the SMILES notation for methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate?
The canonical SMILES for methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate is COC(=O)C(C)CNc1c(Cl)cc(F)cc1Cl.
What is the InChIKey of methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate?
The InChIKey is BDSHEKGGHKXGFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2FNO2/c1-6(11(16)17-2)5-15-10-8(12)3-7(14)4-9(10)13/h3-4,6,15H,5H2,1-2H3.
What are the key properties of methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate?
methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate has a molecular weight of 280.13 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate is sourced from PubChem (CID 83079185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).