C11H12Cl2FNO2 — CID 83079185
methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate (PubChem CID 83079185) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate.
| Compound Name | methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate |
|---|---|
| PubChem CID | 83079185 |
| Molecular Formula | C11H12Cl2FNO2 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | methyl 3-(2,6-dichloro-4-fluoroanilino)-2-methylpropanoate |
| SMILES | COC(=O)C(C)CNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C11H12Cl2FNO2/c1-6(11(16)17-2)5-15-10-8(12)3-7(14)4-9(10)13/h3-4,6,15H,5H2,1-2H3 |
| InChIKey | BDSHEKGGHKXGFL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |