C10H10Cl2FNO2 — CID 83079052
methyl 3-(2,6-dichloro-4-fluoroanilino)propanoate (PubChem CID 83079052) has the molecular formula C10H10Cl2FNO2 and a molecular weight of 266.10 g/mol. Its IUPAC name is methyl 3-(2,6-dichloro-4-fluoroanilino)propanoate.
| Compound Name | methyl 3-(2,6-dichloro-4-fluoroanilino)propanoate |
|---|---|
| PubChem CID | 83079052 |
| Molecular Formula | C10H10Cl2FNO2 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | methyl 3-(2,6-dichloro-4-fluoroanilino)propanoate |
| SMILES | COC(=O)CCNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2FNO2/c1-16-9(15)2-3-14-10-7(11)4-6(13)5-8(10)12/h4-5,14H,2-3H2,1H3 |
| InChIKey | AOSJTTRTLGQEKJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |