C12H16Cl2FNO2 — CID 103179366
2,6-dichloro-4-fluoro-N-[2-(3-methoxypropoxy)ethyl]aniline (PubChem CID 103179366) has the molecular formula C12H16Cl2FNO2 and a molecular weight of 296.17 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-[2-(3-methoxypropoxy)ethyl]aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-[2-(3-methoxypropoxy)ethyl]aniline |
|---|---|
| PubChem CID | 103179366 |
| Molecular Formula | C12H16Cl2FNO2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-[2-(3-methoxypropoxy)ethyl]aniline |
| SMILES | COCCCOCCNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C12H16Cl2FNO2/c1-17-4-2-5-18-6-3-16-12-10(13)7-9(15)8-11(12)14/h7-8,16H,2-6H2,1H3 |
| InChIKey | GYLDKBSRUCSQEC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|