C12H15Cl2N3O2S — CID 103179110
3,5-dichloro-N-[2-(3-methoxypropoxy)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 103179110) has the molecular formula C12H15Cl2N3O2S and a molecular weight of 336.24 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(3-methoxypropoxy)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-[2-(3-methoxypropoxy)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 103179110 |
| Molecular Formula | C12H15Cl2N3O2S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 3,5-dichloro-N-[2-(3-methoxypropoxy)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | COCCCOCCNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H15Cl2N3O2S/c1-18-4-2-5-19-6-3-15-10-8(13)7-9(14)11-12(10)17-20-16-11/h7,15H,2-6H2,1H3 |
| InChIKey | KXTCCOZSCDEXNI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|