C15H14ClF2NO2 — CID 83073516
2-chloro-4,6-difluoro-N-[2-(4-methoxyphenoxy)ethyl]aniline (PubChem CID 83073516) has the molecular formula C15H14ClF2NO2 and a molecular weight of 313.73 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-[2-(4-methoxyphenoxy)ethyl]aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-[2-(4-methoxyphenoxy)ethyl]aniline |
|---|---|
| PubChem CID | 83073516 |
| Molecular Formula | C15H14ClF2NO2 |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-[2-(4-methoxyphenoxy)ethyl]aniline |
| SMILES | COc1ccc(OCCNc2c(F)cc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClF2NO2/c1-20-11-2-4-12(5-3-11)21-7-6-19-15-13(16)8-10(17)9-14(15)18/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | BJGDWOARDRVQKI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|