C15H14ClF2NO — CID 83088365
2-chloro-4,6-difluoro-N-(3-phenoxypropyl)aniline (PubChem CID 83088365) has the molecular formula C15H14ClF2NO and a molecular weight of 297.73 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(3-phenoxypropyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(3-phenoxypropyl)aniline |
|---|---|
| PubChem CID | 83088365 |
| Molecular Formula | C15H14ClF2NO |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(3-phenoxypropyl)aniline |
| SMILES | Fc1cc(F)c(NCCCOc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClF2NO/c16-13-9-11(17)10-14(18)15(13)19-7-4-8-20-12-5-2-1-3-6-12/h1-3,5-6,9-10,19H,4,7-8H2 |
| InChIKey | ARZPZELQBUVGQA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|