C8H9ClF2N2 — CID 130589041
N'-(2-chloro-4,6-difluorophenyl)ethane-1,2-diamine (PubChem CID 130589041) has the molecular formula C8H9ClF2N2 and a molecular weight of 206.62 g/mol. Its IUPAC name is N'-(2-chloro-4,6-difluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(2-chloro-4,6-difluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130589041 |
| Molecular Formula | C8H9ClF2N2 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | N'-(2-chloro-4,6-difluorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C8H9ClF2N2/c9-6-3-5(10)4-7(11)8(6)13-2-1-12/h3-4,13H,1-2,12H2 |
| InChIKey | KTFMCNHLWKQYEN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |