C9H8ClF2N3O2 — CID 82889170
N-carbamoyl-2-(2-chloro-4,6-difluoroanilino)acetamide (PubChem CID 82889170) has the molecular formula C9H8ClF2N3O2 and a molecular weight of 263.63 g/mol. Its IUPAC name is N-carbamoyl-2-(2-chloro-4,6-difluoroanilino)acetamide.
| Compound Name | N-carbamoyl-2-(2-chloro-4,6-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 82889170 |
| Molecular Formula | C9H8ClF2N3O2 |
| Molecular Weight | 263.63 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-carbamoyl-2-(2-chloro-4,6-difluoroanilino)acetamide |
| SMILES | NC(=O)NC(=O)CNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C9H8ClF2N3O2/c10-5-1-4(11)2-6(12)8(5)14-3-7(16)15-9(13)17/h1-2,14H,3H2,(H3,13,15,16,17) |
| InChIKey | QEURFGZGFINFRX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.63 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |